CAS 2177257-91-7 appears in our catalog under these names: 6-Chloro-8-fluoro-2-methyl-[1,2,4]triazolo[1,5-a]pyridine, 95%, 6-CHLORO-8-FLUORO-2-METHYL-(1,2,4)TRIAZOLO(1,5-A)PYRIDINE, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g.
6-chloro-8-fluoro-2-methyl-[1,2,4]triazolo[1,5-a]pyridine (CAS 2177257-91-7) is a chemical compound with the molecular formula C7H5ClFN3 and a molecular weight of 185.58 g/mol. IUPAC name: 6-chloro-8-fluoro-2-methyl-[1,2,4]triazolo[1,5-a]pyridine. InChIKey: RWLDJBUWWQYSIW-UHFFFAOYSA-N.
| Molecular formula | C7H5ClFN3 |
|---|---|
| Molecular weight | 185.58 g/mol |
| IUPAC name | 6-chloro-8-fluoro-2-methyl-[1,2,4]triazolo[1,5-a]pyridine |
| InChIKey | RWLDJBUWWQYSIW-UHFFFAOYSA-N |
| SMILES | CC1=NN2C=C(C=C(C2=N1)F)Cl |
Computed by PubChem (NCBI)