CAS 885520-15-0 is the registry number for 6-Amino-3-chloro-4-fluoro-1H-indazole, 98+%, 98+%. Offered by: Chemat. Available pack sizes: 25mg, 50mg, 100mg, 250mg, 1g.
3-chloro-4-fluoro-2H-indazol-6-amine (CAS 885520-15-0) is a chemical compound with the molecular formula C7H5ClFN3 and a molecular weight of 185.58 g/mol. IUPAC name: 3-chloro-4-fluoro-2H-indazol-6-amine. InChIKey: UWXLXJFEGCXGPI-UHFFFAOYSA-N.
| Molecular formula | C7H5ClFN3 |
|---|---|
| Molecular weight | 185.58 g/mol |
| IUPAC name | 3-chloro-4-fluoro-2H-indazol-6-amine |
| InChIKey | UWXLXJFEGCXGPI-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C2=C(NN=C21)Cl)F)N |
Computed by PubChem (NCBI)