Products 171738-41-3
CAS 171738-41-3 is the registry number for (S)-1-Cbz-5-oxopyrrolidine-2-carboxamide, >98%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g.
Benzyl (2S)-2-carbamoyl-5-oxopyrrolidine-1-carboxylate (CAS 171738-41-3) is a chemical compound with the molecular formula C13H14N2O4 and a molecular weight of 262.26 g/mol. IUPAC name: benzyl (2S)-2-carbamoyl-5-oxopyrrolidine-1-carboxylate. InChIKey: LGUWGZWVSGLKLN-JTQLQIEISA-N.
| Molecular formula | C13H14N2O4 |
|---|---|
| Molecular weight | 262.26 g/mol |
| IUPAC name | benzyl (2S)-2-carbamoyl-5-oxopyrrolidine-1-carboxylate |
| InChIKey | LGUWGZWVSGLKLN-JTQLQIEISA-N |
| SMILES | C1CC(=O)N([C@@H]1C(=O)N)C(=O)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)