CAS 171861-74-8 appears in our catalog under these names: 3-(Benzyloxy)benzamide, 95%, 3-(Benzyloxy)benzamide 96%, 3-(Benzyloxy)benzamide, 96%, 96%, 3-(Benzyloxy)benzamide, 96%. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 25g, 100g, 1g, 5g, 250mg, 10g, 100mg.
3-phenylmethoxybenzamide (CAS 171861-74-8) is a chemical compound with the molecular formula C14H13NO2 and a molecular weight of 227.26 g/mol. IUPAC name: 3-phenylmethoxybenzamide. InChIKey: DNMKNMYJGWJJKJ-UHFFFAOYSA-N.
| Molecular formula | C14H13NO2 |
|---|---|
| Molecular weight | 227.26 g/mol |
| IUPAC name | 3-phenylmethoxybenzamide |
| InChIKey | DNMKNMYJGWJJKJ-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC2=CC=CC(=C2)C(=O)N |
Computed by PubChem (NCBI)