CAS 17191-52-5 is the registry number for tert-Butyl (S)-5-amino-4-(((benzyloxy)carbonyl)amino)-5-oxopentanoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g.
Tert-butyl (4S)-5-amino-5-oxo-4-(phenylmethoxycarbonylamino)pentanoate (CAS 17191-52-5) is a chemical compound with the molecular formula C17H24N2O5 and a molecular weight of 336.4 g/mol. IUPAC name: tert-butyl (4S)-5-amino-5-oxo-4-(phenylmethoxycarbonylamino)pentanoate. InChIKey: FVASJFMQBNYNSN-ZDUSSCGKSA-N.
| Molecular formula | C17H24N2O5 |
|---|---|
| Molecular weight | 336.4 g/mol |
| IUPAC name | tert-butyl (4S)-5-amino-5-oxo-4-(phenylmethoxycarbonylamino)pentanoate |
| InChIKey | FVASJFMQBNYNSN-ZDUSSCGKSA-N |
| SMILES | CC(C)(C)OC(=O)CC[C@@H](C(=O)N)NC(=O)OCC1=CC=CC=C1 |
Computed by PubChem (NCBI)