Products 17191-52-5

CAS 17191-52-5 is the registry number for tert-Butyl (S)-5-amino-4-(((benzyloxy)carbonyl)amino)-5-oxopentanoate, 95%, 95%. Offered by: Chemat. Available pack sizes: 1g, 5g, 10g, 25g, 50g, 100g.

Structural formula: {0} (CAS {1})

Tert-butyl (4S)-5-amino-5-oxo-4-(phenylmethoxycarbonylamino)pentanoate (CAS 17191-52-5) is a chemical compound with the molecular formula C17H24N2O5 and a molecular weight of 336.4 g/mol. IUPAC name: tert-butyl (4S)-5-amino-5-oxo-4-(phenylmethoxycarbonylamino)pentanoate. InChIKey: FVASJFMQBNYNSN-ZDUSSCGKSA-N.

Identity
Molecular formulaC17H24N2O5
Molecular weight336.4 g/mol
IUPAC nametert-butyl (4S)-5-amino-5-oxo-4-(phenylmethoxycarbonylamino)pentanoate
InChIKeyFVASJFMQBNYNSN-ZDUSSCGKSA-N
SMILESCC(C)(C)OC(=O)CC[C@@H](C(=O)N)NC(=O)OCC1=CC=CC=C1

Computed by PubChem (NCBI)