Products 171967-74-1
CAS 171967-74-1 is the registry number for Ramosetron Impurity 4. Offered by: Chemat Brand. Available pack sizes: on request.
3a,7a-dihydroxy-5-(1-methylindole-3-carbonyl)-1,3,4,5,6,7-hexahydrobenzimidazol-2-one (CAS 171967-74-1) is a chemical compound with the molecular formula C17H19N3O4 and a molecular weight of 329.35 g/mol. IUPAC name: 3a,7a-dihydroxy-5-(1-methylindole-3-carbonyl)-1,3,4,5,6,7-hexahydrobenzimidazol-2-one. InChIKey: XXOJAQFCXGVTGZ-UHFFFAOYSA-N.
| Molecular formula | C17H19N3O4 |
|---|---|
| Molecular weight | 329.35 g/mol |
| IUPAC name | 3a,7a-dihydroxy-5-(1-methylindole-3-carbonyl)-1,3,4,5,6,7-hexahydrobenzimidazol-2-one |
| InChIKey | XXOJAQFCXGVTGZ-UHFFFAOYSA-N |
| SMILES | CN1C=C(C2=CC=CC=C21)C(=O)C3CCC4(C(C3)(NC(=O)N4)O)O |
Computed by PubChem (NCBI)