CAS 2206827-14-5 appears in our catalog under these names: Sorafenib tosylate Impurity N, Isopropyl 4-((2-(N-Methylcarbamoyl)-4-pyridyl)oxy)phenylcarbamate, >95% (HPLC), SORAFENIB IMPURITY 10, 95%, SORAFENIB ISOPROPYL CARBAMATE. Offered by: Chemat Brand, TRC, AmBeed, Sigma-Aldrich. Available pack sizes: on request, 100mg, 1g, 25MG.
Propan-2-yl N-[4-[[2-(methylcarbamoyl)-4-pyridinyl]oxy]phenyl]carbamate (CAS 2206827-14-5) is a chemical compound with the molecular formula C17H19N3O4 and a molecular weight of 329.35 g/mol. IUPAC name: propan-2-yl N-[4-[[2-(methylcarbamoyl)-4-pyridinyl]oxy]phenyl]carbamate. InChIKey: OTZYFALTTCYAFP-UHFFFAOYSA-N.
| Molecular formula | C17H19N3O4 |
|---|---|
| Molecular weight | 329.35 g/mol |
| IUPAC name | propan-2-yl N-[4-[[2-(methylcarbamoyl)-4-pyridinyl]oxy]phenyl]carbamate |
| InChIKey | OTZYFALTTCYAFP-UHFFFAOYSA-N |
| SMILES | CC(C)OC(=O)NC1=CC=C(C=C1)OC2=CC(=NC=C2)C(=O)NC |
Computed by PubChem (NCBI)