Products 438571-49-4

CAS 438571-49-4 is the registry number for Ciprofloxacin Impurity 20. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

1-cyclopropyl-7-[2-formamidoethyl(methyl)amino]-4-oxoquinoline-3-carboxylic acid (CAS 438571-49-4) is a chemical compound with the molecular formula C17H19N3O4 and a molecular weight of 329.35 g/mol. IUPAC name: 1-cyclopropyl-7-[2-formamidoethyl(methyl)amino]-4-oxoquinoline-3-carboxylic acid. InChIKey: BUDDUOSIRYDRGX-UHFFFAOYSA-N.

Identity
Molecular formulaC17H19N3O4
Molecular weight329.35 g/mol
IUPAC name1-cyclopropyl-7-[2-formamidoethyl(methyl)amino]-4-oxoquinoline-3-carboxylic acid
InChIKeyBUDDUOSIRYDRGX-UHFFFAOYSA-N
SMILESCN(CCNC=O)C1=CC2=C(C=C1)C(=O)C(=CN2C3CC3)C(=O)O

Computed by PubChem (NCBI)