CAS 438571-49-4 is the registry number for Ciprofloxacin Impurity 20. Offered by: Chemat Brand. Available pack sizes: on request.
1-cyclopropyl-7-[2-formamidoethyl(methyl)amino]-4-oxoquinoline-3-carboxylic acid (CAS 438571-49-4) is a chemical compound with the molecular formula C17H19N3O4 and a molecular weight of 329.35 g/mol. IUPAC name: 1-cyclopropyl-7-[2-formamidoethyl(methyl)amino]-4-oxoquinoline-3-carboxylic acid. InChIKey: BUDDUOSIRYDRGX-UHFFFAOYSA-N.
| Molecular formula | C17H19N3O4 |
|---|---|
| Molecular weight | 329.35 g/mol |
| IUPAC name | 1-cyclopropyl-7-[2-formamidoethyl(methyl)amino]-4-oxoquinoline-3-carboxylic acid |
| InChIKey | BUDDUOSIRYDRGX-UHFFFAOYSA-N |
| SMILES | CN(CCNC=O)C1=CC2=C(C=C1)C(=O)C(=CN2C3CC3)C(=O)O |
Computed by PubChem (NCBI)