Products 6371-55-7

CAS 6371-55-7 is the registry number for 2-[4-(Bis(2-hydroxyethyl)amino)phenyl]diazenylbenzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

2-[[4-[bis(2-hydroxyethyl)amino]phenyl]diazenyl]benzoic acid (CAS 6371-55-7) is a chemical compound with the molecular formula C17H19N3O4 and a molecular weight of 329.35 g/mol. IUPAC name: 2-[[4-[bis(2-hydroxyethyl)amino]phenyl]diazenyl]benzoic acid. InChIKey: KAOXHXDKFGCWPK-UHFFFAOYSA-N.

Identity
Molecular formulaC17H19N3O4
Molecular weight329.35 g/mol
IUPAC name2-[[4-[bis(2-hydroxyethyl)amino]phenyl]diazenyl]benzoic acid
InChIKeyKAOXHXDKFGCWPK-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C(=O)O)N=NC2=CC=C(C=C2)N(CCO)CCO

Computed by PubChem (NCBI)