Products 1795133-22-0
CAS 1795133-22-0 is the registry number for Quipazine-d8 Maleate. Offered by: TRC. Available pack sizes: 25mg.
(Z)-but-2-enedioic acid;2-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)quinoline (CAS 1795133-22-0) is a chemical compound with the molecular formula C17H19N3O4 and a molecular weight of 337.40 g/mol. IUPAC name: (Z)-but-2-enedioic acid;2-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)quinoline. InChIKey: QYJJDHZHSCTBII-NHXHBPKDSA-N.
| Molecular formula | C17H19N3O4 |
|---|---|
| Molecular weight | 337.40 g/mol |
| IUPAC name | (Z)-but-2-enedioic acid;2-(2,2,3,3,5,5,6,6-octadeuteriopiperazin-1-yl)quinoline |
| InChIKey | QYJJDHZHSCTBII-NHXHBPKDSA-N |
| SMILES | [2H]C1(C(N(C(C(N1)([2H])[2H])([2H])[2H])C2=NC3=CC=CC=C3C=C2)([2H])[2H])[2H].C(=C\C(=O)O)\C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
Quipazine-d8 Maleate, Quipazine-d8Maleate