CAS 1721-13-7 appears in our catalog under these names: 2,6-Dimethyl-nicotinic acid ethyl ester, 95%, Ethyl 2,6–dimethyl nicotinate. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 250mg, 5g.
Ethyl 2,6-dimethylpyridine-3-carboxylate (CAS 1721-13-7) is a chemical compound with the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. IUPAC name: ethyl 2,6-dimethylpyridine-3-carboxylate. InChIKey: IDTTVGCBBDITAR-UHFFFAOYSA-N.
| Molecular formula | C10H13NO2 |
|---|---|
| Molecular weight | 179.22 g/mol |
| IUPAC name | ethyl 2,6-dimethylpyridine-3-carboxylate |
| InChIKey | IDTTVGCBBDITAR-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=C(N=C(C=C1)C)C |
Computed by PubChem (NCBI)