CAS 17231-84-4 is the registry number for 1-(2,4,5-Trimethoxyphenyl)-2-nitropropene. Offered by: Biosynth. Available pack sizes: 5mg, 2mg, 10mg, 25mg.
1,2,4-trimethoxy-5-(2-nitroprop-1-enyl)benzene (CAS 17231-84-4) is a chemical compound with the molecular formula C12H15NO5 and a molecular weight of 253.25 g/mol. IUPAC name: 1,2,4-trimethoxy-5-(2-nitroprop-1-enyl)benzene. InChIKey: YJLWVSYNZFMHTK-UHFFFAOYSA-N.
| Molecular formula | C12H15NO5 |
|---|---|
| Molecular weight | 253.25 g/mol |
| IUPAC name | 1,2,4-trimethoxy-5-(2-nitroprop-1-enyl)benzene |
| InChIKey | YJLWVSYNZFMHTK-UHFFFAOYSA-N |
| SMILES | CC(=CC1=CC(=C(C=C1OC)OC)OC)[N+](=O)[O-] |
Computed by PubChem (NCBI)