CAS 172602-81-2 appears in our catalog under these names: Moxifloxacin Impurity 102, Moxifloxacin Impurity 65. Offered by: Chemat Brand. Available pack sizes: on request.
3-ethoxy-2,4,5-trifluorobenzoyl chloride (CAS 172602-81-2) is a chemical compound with the molecular formula C9H6ClF3O2 and a molecular weight of 238.59 g/mol. IUPAC name: 3-ethoxy-2,4,5-trifluorobenzoyl chloride. InChIKey: WLKKYBXWLLMSKG-UHFFFAOYSA-N.
| Molecular formula | C9H6ClF3O2 |
|---|---|
| Molecular weight | 238.59 g/mol |
| IUPAC name | 3-ethoxy-2,4,5-trifluorobenzoyl chloride |
| InChIKey | WLKKYBXWLLMSKG-UHFFFAOYSA-N |
| SMILES | CCOC1=C(C(=CC(=C1F)F)C(=O)Cl)F |
Computed by PubChem (NCBI)