Products 98187-17-8

CAS 98187-17-8 is the registry number for 4-Methoxy-2-(trifluoromethyl)benzoyl chloride, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

4-methoxy-2-(trifluoromethyl)benzoyl chloride (CAS 98187-17-8) is a chemical compound with the molecular formula C9H6ClF3O2 and a molecular weight of 238.59 g/mol. IUPAC name: 4-methoxy-2-(trifluoromethyl)benzoyl chloride. InChIKey: MYGJNVNUYJLTOZ-UHFFFAOYSA-N.

Identity
Molecular formulaC9H6ClF3O2
Molecular weight238.59 g/mol
IUPAC name4-methoxy-2-(trifluoromethyl)benzoyl chloride
InChIKeyMYGJNVNUYJLTOZ-UHFFFAOYSA-N
SMILESCOC1=CC(=C(C=C1)C(=O)Cl)C(F)(F)F

Computed by PubChem (NCBI)