CAS 521064-74-4 appears in our catalog under these names: 5-Chloro-2-(trifluoromethyl)benzoic acid methyl ester, 95%, Methyl 5-chloro-2-(trifluoromethyl)benzoate 97%, Methyl 5-chloro-2-(trifluoromethyl)benzoate, ≥95%, ≥95%, 5-Chloro-2-(trifluoromethyl)benzoic acid methyl ester. Offered by: Combi-blocks, Ambeed, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
Methyl 5-chloro-2-(trifluoromethyl)benzoate (CAS 521064-74-4) is a chemical compound with the molecular formula C9H6ClF3O2 and a molecular weight of 238.59 g/mol. IUPAC name: methyl 5-chloro-2-(trifluoromethyl)benzoate. InChIKey: NILRXMRLNGSFLM-UHFFFAOYSA-N.
| Molecular formula | C9H6ClF3O2 |
|---|---|
| Molecular weight | 238.59 g/mol |
| IUPAC name | methyl 5-chloro-2-(trifluoromethyl)benzoate |
| InChIKey | NILRXMRLNGSFLM-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1)Cl)C(F)(F)F |
Computed by PubChem (NCBI)