CAS 378231-19-7 is the registry number for Methyl 2-chloro-3-(trifluoromethyl)benzoate, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 25g, 10g, 5g.
Methyl 2-chloro-3-(trifluoromethyl)benzoate (CAS 378231-19-7) is a chemical compound with the molecular formula C9H6ClF3O2 and a molecular weight of 238.59 g/mol. IUPAC name: methyl 2-chloro-3-(trifluoromethyl)benzoate. InChIKey: LEECXUQPLLXGGK-UHFFFAOYSA-N.
| Molecular formula | C9H6ClF3O2 |
|---|---|
| Molecular weight | 238.59 g/mol |
| IUPAC name | methyl 2-chloro-3-(trifluoromethyl)benzoate |
| InChIKey | LEECXUQPLLXGGK-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C(=CC=C1)C(F)(F)F)Cl |
Computed by PubChem (NCBI)