CAS 172657-04-4 appears in our catalog under these names: 2,3-Difluoro-4,5-dimethoxybenzaldehyde, 95%, 2,3-Difluoro-4,5-dimethoxybenzaldehyde, ≥95%, ≥95%, 2,3-Difluoro-4,5-dimethoxybenzaldehyde, >=95%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 5g, 10g, 1g, 250mg.
2,3-difluoro-4,5-dimethoxybenzaldehyde (CAS 172657-04-4) is a chemical compound with the molecular formula C9H8F2O3 and a molecular weight of 202.15 g/mol. IUPAC name: 2,3-difluoro-4,5-dimethoxybenzaldehyde. InChIKey: FMRKIWKURWEJCE-UHFFFAOYSA-N.
| Molecular formula | C9H8F2O3 |
|---|---|
| Molecular weight | 202.15 g/mol |
| IUPAC name | 2,3-difluoro-4,5-dimethoxybenzaldehyde |
| InChIKey | FMRKIWKURWEJCE-UHFFFAOYSA-N |
| SMILES | COC1=C(C(=C(C(=C1)C=O)F)F)OC |
Computed by PubChem (NCBI)