Products 172721-98-1
CAS 172721-98-1 appears in our catalog under these names: (3S,6R)-Lateritin, Lateritin. Offered by: Chemat, MedChemExpress. Available pack sizes: 1mg, Get quote.
(3R,6R)-3-benzyl-4-methyl-6-propan-2-ylmorpholine-2,5-dione (CAS 172721-98-1) is a chemical compound with the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. IUPAC name: (3R,6R)-3-benzyl-4-methyl-6-propan-2-ylmorpholine-2,5-dione. InChIKey: YOKBTBNVNCFOBF-CHWSQXEVSA-N.
| Molecular formula | C15H19NO3 |
|---|---|
| Molecular weight | 261.32 g/mol |
| IUPAC name | (3R,6R)-3-benzyl-4-methyl-6-propan-2-ylmorpholine-2,5-dione |
| InChIKey | YOKBTBNVNCFOBF-CHWSQXEVSA-N |
| SMILES | CC(C)[C@@H]1C(=O)N([C@@H](C(=O)O1)CC2=CC=CC=C2)C |
Computed by PubChem (NCBI)