CAS 2180287-51-6 is the registry number for 2,5-Morpholinedione, 4-methyl-6-(1-methylethyl)-3-(phenylmethyl)-. Offered by: TargetMol, Chemat. Available pack sizes: 5mg, 10mg.
3-benzyl-4-methyl-6-propan-2-ylmorpholine-2,5-dione (CAS 2180287-51-6) is a chemical compound with the molecular formula C15H19NO3 and a molecular weight of 261.32 g/mol. IUPAC name: 3-benzyl-4-methyl-6-propan-2-ylmorpholine-2,5-dione. InChIKey: YOKBTBNVNCFOBF-UHFFFAOYSA-N.
| Molecular formula | C15H19NO3 |
|---|---|
| Molecular weight | 261.32 g/mol |
| IUPAC name | 3-benzyl-4-methyl-6-propan-2-ylmorpholine-2,5-dione |
| InChIKey | YOKBTBNVNCFOBF-UHFFFAOYSA-N |
| SMILES | CC(C)C1C(=O)N(C(C(=O)O1)CC2=CC=CC=C2)C |
Computed by PubChem (NCBI)