CAS 17279-39-9 is the registry number for N,N-Dimethylamphetamine. Offered by: TRC. Available pack sizes: 100mg, 10mg, 50mg.
(2S)-N,N-dimethyl-1-phenylpropan-2-amine (CAS 17279-39-9) is a chemical compound with the molecular formula C11H17N and a molecular weight of 163.26 g/mol. IUPAC name: (2S)-N,N-dimethyl-1-phenylpropan-2-amine. InChIKey: OBDSVYOSYSKVMX-JTQLQIEISA-N.
| Molecular formula | C11H17N |
|---|---|
| Molecular weight | 163.26 g/mol |
| IUPAC name | (2S)-N,N-dimethyl-1-phenylpropan-2-amine |
| InChIKey | OBDSVYOSYSKVMX-JTQLQIEISA-N |
| SMILES | C[C@@H](CC1=CC=CC=C1)N(C)C |
Computed by PubChem (NCBI)