CAS 786580-21-0 is the registry number for N,N-Dimethylamphetamine-d6, >95% (HPLC). Offered by: TRC. Available pack sizes: 10mg, 1mg.
(2S)-1-phenyl-N,N-bis(trideuteriomethyl)propan-2-amine (CAS 786580-21-0) is a chemical compound with the molecular formula C11H17N and a molecular weight of 169.30 g/mol. IUPAC name: (2S)-1-phenyl-N,N-bis(trideuteriomethyl)propan-2-amine. InChIKey: OBDSVYOSYSKVMX-LJTFXESQSA-N.
| Molecular formula | C11H17N |
|---|---|
| Molecular weight | 169.30 g/mol |
| IUPAC name | (2S)-1-phenyl-N,N-bis(trideuteriomethyl)propan-2-amine |
| InChIKey | OBDSVYOSYSKVMX-LJTFXESQSA-N |
| SMILES | [2H]C([2H])([2H])N([C@@H](C)CC1=CC=CC=C1)C([2H])([2H])[2H] |
Computed by PubChem (NCBI)