Products 172791-93-4
CAS 172791-93-4 is the registry number for 2-(((4-Methoxybenzyl)oxy)methyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane, 95%, 95%. Offered by: Chemat. Available pack sizes: 10mg, 25mg, 100mg.
2-[(4-methoxyphenyl)methoxymethyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane (CAS 172791-93-4) is a chemical compound with the molecular formula C15H23BO4 and a molecular weight of 278.15 g/mol. IUPAC name: 2-[(4-methoxyphenyl)methoxymethyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane. InChIKey: GYWHMIODRYGUDL-UHFFFAOYSA-N.
| Molecular formula | C15H23BO4 |
|---|---|
| Molecular weight | 278.15 g/mol |
| IUPAC name | 2-[(4-methoxyphenyl)methoxymethyl]-4,4,5,5-tetramethyl-1,3,2-dioxaborolane |
| InChIKey | GYWHMIODRYGUDL-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)COCC2=CC=C(C=C2)OC |
Computed by PubChem (NCBI)