CAS 1261078-12-9 appears in our catalog under these names: FMOC-L-Glutamic Acid-13C5,15N- 5-t-butyl ester, 98% +98%atom%13C,15N, Fmoc-Glu(OtBu)-OH-13C5,15N, 96.0%. Offered by: Chemat Brand, MedChemExpress. Available pack sizes: on request, 5 mg, 1 mg, 10 mg, 25 mg, 100 mg, 50 mg.
(2S)-2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)-5-[(2-methylpropan-2-yl)oxy]-5-oxo(1,2,3,4,5-13C5)pentanoic acid (CAS 1261078-12-9) is a chemical compound with the molecular formula C24H27NO6 and a molecular weight of 431.4 g/mol. IUPAC name: (2S)-2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)-5-[(2-methylpropan-2-yl)oxy]-5-oxo(1,2,3,4,5-13C5)pentanoic acid. InChIKey: OTKXCALUHMPIGM-ZTILORDDSA-N.
| Molecular formula | C24H27NO6 |
|---|---|
| Molecular weight | 431.4 g/mol |
| IUPAC name | (2S)-2-(9H-fluoren-9-ylmethoxycarbonyl(15N)amino)-5-[(2-methylpropan-2-yl)oxy]-5-oxo(1,2,3,4,5-13C5)pentanoic acid |
| InChIKey | OTKXCALUHMPIGM-ZTILORDDSA-N |
| SMILES | CC(C)(C)O[13C](=O)[13CH2][13CH2][13C@@H]([13C](=O)O)[15NH]C(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13 |
Computed by PubChem (NCBI)