CAS 17285-00-6 is the registry number for N-(6-Chloropyridazin-3-yl)-N-methylglycine, 98%. Offered by: AmBeed. Available pack sizes: 10g, 5g.
2-[(6-chloropyridazin-3-yl)-methylamino]acetic acid (CAS 17285-00-6) is a chemical compound with the molecular formula C7H8ClN3O2 and a molecular weight of 201.61 g/mol. IUPAC name: 2-[(6-chloropyridazin-3-yl)-methylamino]acetic acid. InChIKey: DKHGVAYHAZQICB-UHFFFAOYSA-N.
| Molecular formula | C7H8ClN3O2 |
|---|---|
| Molecular weight | 201.61 g/mol |
| IUPAC name | 2-[(6-chloropyridazin-3-yl)-methylamino]acetic acid |
| InChIKey | DKHGVAYHAZQICB-UHFFFAOYSA-N |
| SMILES | CN(CC(=O)O)C1=NN=C(C=C1)Cl |
Computed by PubChem (NCBI)