Products 17291-95-1
CAS 17291-95-1 is the registry number for 1-(3,4-Dichlorophenyl)-2-methylpropan-1-amine, 95%. Offered by: AmBeed. Available pack sizes: 5g.
1-(3,4-dichlorophenyl)-2-methylpropan-1-amine (CAS 17291-95-1) is a chemical compound with the molecular formula C10H13Cl2N and a molecular weight of 218.12 g/mol. IUPAC name: 1-(3,4-dichlorophenyl)-2-methylpropan-1-amine. InChIKey: GBHNWWAAJIPAFF-UHFFFAOYSA-N.
| Molecular formula | C10H13Cl2N |
|---|---|
| Molecular weight | 218.12 g/mol |
| IUPAC name | 1-(3,4-dichlorophenyl)-2-methylpropan-1-amine |
| InChIKey | GBHNWWAAJIPAFF-UHFFFAOYSA-N |
| SMILES | CC(C)C(C1=CC(=C(C=C1)Cl)Cl)N |
Computed by PubChem (NCBI)