CAS 172944-87-5 is the registry number for 2-(3,5-Dichlorophenyl)benzo(D)oxazole. Offered by: Biosynth. Available pack sizes: 1g, 2g, 5g, 10g.
2-(3,5-dichlorophenyl)-1,3-benzoxazole (CAS 172944-87-5) is a chemical compound with the molecular formula C13H7Cl2NO and a molecular weight of 264.10 g/mol. IUPAC name: 2-(3,5-dichlorophenyl)-1,3-benzoxazole. InChIKey: PBKJYZISDWROOZ-UHFFFAOYSA-N.
| Molecular formula | C13H7Cl2NO |
|---|---|
| Molecular weight | 264.10 g/mol |
| IUPAC name | 2-(3,5-dichlorophenyl)-1,3-benzoxazole |
| InChIKey | PBKJYZISDWROOZ-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(O2)C3=CC(=CC(=C3)Cl)Cl |
Computed by PubChem (NCBI)