CAS 3164-12-3 is the registry number for 2-(3,4-Dichlorophenyl)benzo[d]oxazole, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(3,4-dichlorophenyl)-1,3-benzoxazole (CAS 3164-12-3) is a chemical compound with the molecular formula C13H7Cl2NO and a molecular weight of 264.10 g/mol. IUPAC name: 2-(3,4-dichlorophenyl)-1,3-benzoxazole. InChIKey: DSLOEULHWIEJEX-UHFFFAOYSA-N.
| Molecular formula | C13H7Cl2NO |
|---|---|
| Molecular weight | 264.10 g/mol |
| IUPAC name | 2-(3,4-dichlorophenyl)-1,3-benzoxazole |
| InChIKey | DSLOEULHWIEJEX-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)N=C(O2)C3=CC(=C(C=C3)Cl)Cl |
Computed by PubChem (NCBI)