Products 1798799-44-6
CAS 1798799-44-6 is the registry number for 4,7-Dichloro-2-(2-furyl)quinoline, 95-<97%. Offered by: Hoffman Fine Chemicals. Available pack sizes: 500mg, 1g, 2,5g, 5g, 10g.
4,7-dichloro-2-(furan-2-yl)quinoline (CAS 1798799-44-6) is a chemical compound with the molecular formula C13H7Cl2NO and a molecular weight of 264.10 g/mol. IUPAC name: 4,7-dichloro-2-(furan-2-yl)quinoline. InChIKey: RJFXNIGUFHNMQR-UHFFFAOYSA-N.
| Molecular formula | C13H7Cl2NO |
|---|---|
| Molecular weight | 264.10 g/mol |
| IUPAC name | 4,7-dichloro-2-(furan-2-yl)quinoline |
| InChIKey | RJFXNIGUFHNMQR-UHFFFAOYSA-N |
| SMILES | C1=COC(=C1)C2=NC3=C(C=CC(=C3)Cl)C(=C2)Cl |
Computed by PubChem (NCBI)