Products 173301-08-1
CAS 173301-08-1 is the registry number for 1-((6-Bromonaphthalen-2-yl)oxy)propan-2-one. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
1-(6-bromonaphthalen-2-yl)oxypropan-2-one (CAS 173301-08-1) is a chemical compound with the molecular formula C13H11BrO2 and a molecular weight of 279.13 g/mol. IUPAC name: 1-(6-bromonaphthalen-2-yl)oxypropan-2-one. InChIKey: IFARMRBFYYTWCS-UHFFFAOYSA-N.
| Molecular formula | C13H11BrO2 |
|---|---|
| Molecular weight | 279.13 g/mol |
| IUPAC name | 1-(6-bromonaphthalen-2-yl)oxypropan-2-one |
| InChIKey | IFARMRBFYYTWCS-UHFFFAOYSA-N |
| SMILES | CC(=O)COC1=CC2=C(C=C1)C=C(C=C2)Br |
Computed by PubChem (NCBI)