CAS 17332-70-6 appears in our catalog under these names: 7-Methyl-dl-tryptophan, 95%, 7–Methyl–DL–tryptophan, 7-Methyl-DL-tryptophan, H-DL-Trp(7-Me)-OH 99%, 2-Amino-3-(7-methyl-1H-indol-3-yl)propanoic acid, 99%, 99%. Offered by: Combi-blocks, GLPBio, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 250mg, 100mg, 500mg, 1000mg, 5g, 10g, 25g.
2-amino-3-(7-methyl-1H-indol-3-yl)propanoic acid (CAS 17332-70-6) is a chemical compound with the molecular formula C12H14N2O2 and a molecular weight of 218.25 g/mol. IUPAC name: 2-amino-3-(7-methyl-1H-indol-3-yl)propanoic acid. InChIKey: KBOZNJNHBBROHM-UHFFFAOYSA-N.
| Molecular formula | C12H14N2O2 |
|---|---|
| Molecular weight | 218.25 g/mol |
| IUPAC name | 2-amino-3-(7-methyl-1H-indol-3-yl)propanoic acid |
| InChIKey | KBOZNJNHBBROHM-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C(=CN2)CC(C(=O)O)N |
Computed by PubChem (NCBI)