CAS 173406-71-8 is the registry number for N'-Acetyl-3-bromobenzohydrazide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N'-acetyl-3-bromobenzohydrazide (CAS 173406-71-8) is a chemical compound with the molecular formula C9H9BrN2O2 and a molecular weight of 257.08 g/mol. IUPAC name: N'-acetyl-3-bromobenzohydrazide. InChIKey: XEYPICKTYZCASV-UHFFFAOYSA-N.
| Molecular formula | C9H9BrN2O2 |
|---|---|
| Molecular weight | 257.08 g/mol |
| IUPAC name | N'-acetyl-3-bromobenzohydrazide |
| InChIKey | XEYPICKTYZCASV-UHFFFAOYSA-N |
| SMILES | CC(=O)NNC(=O)C1=CC(=CC=C1)Br |
Computed by PubChem (NCBI)