Products 17350-74-2
CAS 17350-74-2 appears in our catalog under these names: (2S)-2-(Dimethylamino)-3-(4-hydroxyphenyl)propanoic acid, N,N-Dimethyl L-Tyrosine, (S)-2-(Dimethylamino)-3-(4-hydroxyphenyl)propanoic acid, 95+%. Offered by: Biosynth, TRC, AmBeed. Available pack sizes: 50mg, 0,5g, 1g.
(2S)-2-(dimethylamino)-3-(4-hydroxyphenyl)propanoic acid (CAS 17350-74-2) is a chemical compound with the molecular formula C11H15NO3 and a molecular weight of 209.24 g/mol. IUPAC name: (2S)-2-(dimethylamino)-3-(4-hydroxyphenyl)propanoic acid. InChIKey: WJJGAKCAAJOICV-JTQLQIEISA-N.
| Molecular formula | C11H15NO3 |
|---|---|
| Molecular weight | 209.24 g/mol |
| IUPAC name | (2S)-2-(dimethylamino)-3-(4-hydroxyphenyl)propanoic acid |
| InChIKey | WJJGAKCAAJOICV-JTQLQIEISA-N |
| SMILES | CN(C)[C@@H](CC1=CC=C(C=C1)O)C(=O)O |
Computed by PubChem (NCBI)