CAS 173600-14-1 appears in our catalog under these names: 1–Isopropyl–1H–indazole–3–carboxylic acid, 1-Isopropyl-1h-indazole-3-carboxylic acid, 95%. Offered by: GLPBio, Combi-blocks. Available pack sizes: 100mg, 1g, 250mg.
1-propan-2-ylindazole-3-carboxylic acid (CAS 173600-14-1) is a chemical compound with the molecular formula C11H12N2O2 and a molecular weight of 204.22 g/mol. IUPAC name: 1-propan-2-ylindazole-3-carboxylic acid. InChIKey: FHUPHXAYPNYFIU-UHFFFAOYSA-N.
| Molecular formula | C11H12N2O2 |
|---|---|
| Molecular weight | 204.22 g/mol |
| IUPAC name | 1-propan-2-ylindazole-3-carboxylic acid |
| InChIKey | FHUPHXAYPNYFIU-UHFFFAOYSA-N |
| SMILES | CC(C)N1C2=CC=CC=C2C(=N1)C(=O)O |
Computed by PubChem (NCBI)