CAS 1737-23-1 is the registry number for 2,2,2-Trifluoro-1-(3-methylphenyl)ethan-1-ol. Offered by: Biosynth. Available pack sizes: 250mg, 2,5g.
2,2,2-trifluoro-1-(3-methylphenyl)ethanol (CAS 1737-23-1) is a chemical compound with the molecular formula C9H9F3O and a molecular weight of 190.16 g/mol. IUPAC name: 2,2,2-trifluoro-1-(3-methylphenyl)ethanol. InChIKey: MTCMVMYGHLVKTA-UHFFFAOYSA-N.
| Molecular formula | C9H9F3O |
|---|---|
| Molecular weight | 190.16 g/mol |
| IUPAC name | 2,2,2-trifluoro-1-(3-methylphenyl)ethanol |
| InChIKey | MTCMVMYGHLVKTA-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC=C1)C(C(F)(F)F)O |
Computed by PubChem (NCBI)