CAS 1738-77-8 appears in our catalog under these names: H–Leu–OBzl·TosOH, H-L-Leu-OBzl*Tos, L-Leucine benzyl ester 4-toluenesulfonate salt, L-Leucine Benzyl Ester p-Toluenesulfonate, >98.0%(HPLC)(T), H-Leu-OBzl TsOH 98%. Offered by: GLPBio, Iris Biotech, Biosynth, TCI, Ambeed. Available pack sizes: 500g, 25g, 100g, 50g, 5g, 250g, 1000g, 500 g.
Benzyl (2S)-2-amino-4-methylpentanoate;4-methylbenzenesulfonic acid (CAS 1738-77-8) is a chemical compound with the molecular formula C20H27NO5S and a molecular weight of 393.5 g/mol. IUPAC name: benzyl (2S)-2-amino-4-methylpentanoate;4-methylbenzenesulfonic acid. InChIKey: QTQGHKVYLQBJLO-YDALLXLXSA-N.
| Molecular formula | C20H27NO5S |
|---|---|
| Molecular weight | 393.5 g/mol |
| IUPAC name | benzyl (2S)-2-amino-4-methylpentanoate;4-methylbenzenesulfonic acid |
| InChIKey | QTQGHKVYLQBJLO-YDALLXLXSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.CC(C)C[C@@H](C(=O)OCC1=CC=CC=C1)N |
Computed by PubChem (NCBI)