CAS 735305-61-0 is the registry number for 3-{(1-(adamantan-1-yl)ethyl)sulfamoyl}-4-methoxybenzoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
3-[1-(1-adamantyl)ethylsulfamoyl]-4-methoxybenzoic acid (CAS 735305-61-0) is a chemical compound with the molecular formula C20H27NO5S and a molecular weight of 393.5 g/mol. IUPAC name: 3-[1-(1-adamantyl)ethylsulfamoyl]-4-methoxybenzoic acid. InChIKey: DQZJWLUGBTYYLM-UHFFFAOYSA-N.
| Molecular formula | C20H27NO5S |
|---|---|
| Molecular weight | 393.5 g/mol |
| IUPAC name | 3-[1-(1-adamantyl)ethylsulfamoyl]-4-methoxybenzoic acid |
| InChIKey | DQZJWLUGBTYYLM-UHFFFAOYSA-N |
| SMILES | CC(C12CC3CC(C1)CC(C3)C2)NS(=O)(=O)C4=C(C=CC(=C4)C(=O)O)OC |
Computed by PubChem (NCBI)