CAS 63219-55-6 appears in our catalog under these names: Benzyl (2s)-2-aminohexanoate toluene-4-sulfonic acid salt, 95%, Benzyl (2S)–2–aminohexanoate toluene–4–sulfonic acid salt. Offered by: Combi-blocks, GLPBio. Available pack sizes: 1g, 25mg.
Benzyl (2S)-2-aminohexanoate;4-methylbenzenesulfonic acid (CAS 63219-55-6) is a chemical compound with the molecular formula C20H27NO5S and a molecular weight of 393.5 g/mol. IUPAC name: benzyl (2S)-2-aminohexanoate;4-methylbenzenesulfonic acid. InChIKey: XJHIQHCDQIIQCQ-YDALLXLXSA-N.
| Molecular formula | C20H27NO5S |
|---|---|
| Molecular weight | 393.5 g/mol |
| IUPAC name | benzyl (2S)-2-aminohexanoate;4-methylbenzenesulfonic acid |
| InChIKey | XJHIQHCDQIIQCQ-YDALLXLXSA-N |
| SMILES | CCCC[C@@H](C(=O)OCC1=CC=CC=C1)N.CC1=CC=C(C=C1)S(=O)(=O)O |
Computed by PubChem (NCBI)