Products 174224-62-5
CAS 174224-62-5 is the registry number for Benzyl N-methyl-L-valinate 4-methylbenzenesulfonate, 97%, 97%. Offered by: Chemat. Available pack sizes: 1g, 5g.
Benzyl (2S)-3-methyl-2-(methylamino)butanoate;4-methylbenzenesulfonic acid (CAS 174224-62-5) is a chemical compound with the molecular formula C20H27NO5S and a molecular weight of 393.5 g/mol. IUPAC name: benzyl (2S)-3-methyl-2-(methylamino)butanoate;4-methylbenzenesulfonic acid. InChIKey: XBFVKORYWHMVCH-YDALLXLXSA-N.
| Molecular formula | C20H27NO5S |
|---|---|
| Molecular weight | 393.5 g/mol |
| IUPAC name | benzyl (2S)-3-methyl-2-(methylamino)butanoate;4-methylbenzenesulfonic acid |
| InChIKey | XBFVKORYWHMVCH-YDALLXLXSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)O.CC(C)[C@@H](C(=O)OCC1=CC=CC=C1)NC |
Computed by PubChem (NCBI)
Synonyms:
Benzyl methyl-L-valinate 4-methylbenzenesulfonate, L-Valine, N-methyl-, phenylmethyl ester, 4-methylbenzenesulfonate, N-ALPHA-METHYL-L-VALINE BENZYL ESTER P-TOSYLATE, Benzyl N-methyl-L-valinate 4-methylbenzenesulfonate, benzyl (2S)-3-methyl-2-(methylamino)butanoate;4-methylbenzenesulfonic acid, N-Me-Val-OBzl TOsOH, N-ME-VAL-OBZL P-TOSYLATE, N-Me-Val-OBzl . p-tosylate