CAS 17384-95-1 appears in our catalog under these names: 3-(3-Chloro-4-methoxy-phenyl)-acrylic acid ethyl ester, 95%, (E)-Ethyl 3-(3-chloro-4-methoxyphenyl)acrylate. Offered by: Combi-blocks, Fluorochem. Available pack sizes: 5g, 10g, 25g, 1g, 250mg.
Ethyl (E)-3-(3-chloro-4-methoxyphenyl)prop-2-enoate (CAS 17384-95-1) is a chemical compound with the molecular formula C12H13ClO3 and a molecular weight of 240.68 g/mol. IUPAC name: ethyl (E)-3-(3-chloro-4-methoxyphenyl)prop-2-enoate. InChIKey: BKYWZQDYDKFGSF-FNORWQNLSA-N.
| Molecular formula | C12H13ClO3 |
|---|---|
| Molecular weight | 240.68 g/mol |
| IUPAC name | ethyl (E)-3-(3-chloro-4-methoxyphenyl)prop-2-enoate |
| InChIKey | BKYWZQDYDKFGSF-FNORWQNLSA-N |
| SMILES | CCOC(=O)/C=C/C1=CC(=C(C=C1)OC)Cl |
Computed by PubChem (NCBI)