CAS 2106810-09-5 is the registry number for Methyl 6-chloro-8-methylchromane-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 6-chloro-8-methyl-3,4-dihydro-2H-chromene-3-carboxylate (CAS 2106810-09-5) is a chemical compound with the molecular formula C12H13ClO3 and a molecular weight of 240.68 g/mol. IUPAC name: methyl 6-chloro-8-methyl-3,4-dihydro-2H-chromene-3-carboxylate. InChIKey: ZKOIYAGPEGRKDZ-UHFFFAOYSA-N.
| Molecular formula | C12H13ClO3 |
|---|---|
| Molecular weight | 240.68 g/mol |
| IUPAC name | methyl 6-chloro-8-methyl-3,4-dihydro-2H-chromene-3-carboxylate |
| InChIKey | ZKOIYAGPEGRKDZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC2=C1OCC(C2)C(=O)OC)Cl |
Computed by PubChem (NCBI)