Products 473706-23-9
CAS 473706-23-9 appears in our catalog under these names: 4-(3-Chlorophenyl)oxane-4-carboxylic acid, 95%, 4-(3-Chlorophenyl)tetrahydro-2H-pyran-4-carboxylic acid, 95+%, 4-(3-Chlorophenyl)tetrahydro-2H-pyran-4-carboxylic acid, 4-(3-Chlorophenyl)tetrahydro-2H-pyran-4-carboxylic acid, 97%. Offered by: Combi-blocks, AmBeed, Biosynth, Fluorochem. Available pack sizes: 250mg, 1g, 5g, 2,5g.
4-(3-chlorophenyl)oxane-4-carboxylic acid (CAS 473706-23-9) is a chemical compound with the molecular formula C12H13ClO3 and a molecular weight of 240.68 g/mol. IUPAC name: 4-(3-chlorophenyl)oxane-4-carboxylic acid. InChIKey: IFGNECIEJYKTRC-UHFFFAOYSA-N.
| Molecular formula | C12H13ClO3 |
|---|---|
| Molecular weight | 240.68 g/mol |
| IUPAC name | 4-(3-chlorophenyl)oxane-4-carboxylic acid |
| InChIKey | IFGNECIEJYKTRC-UHFFFAOYSA-N |
| SMILES | C1COCCC1(C2=CC(=CC=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)