Products 53503-49-4

CAS 53503-49-4 is the registry number for 4-(4-Chloro-phenyl)-4-oxo-butyric acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 250mg.

Structural formula: {0} (CAS {1})

Ethyl 4-(4-chlorophenyl)-4-oxobutanoate (CAS 53503-49-4) is a chemical compound with the molecular formula C12H13ClO3 and a molecular weight of 240.68 g/mol. IUPAC name: ethyl 4-(4-chlorophenyl)-4-oxobutanoate. InChIKey: YKJFOAUMSHLSEB-UHFFFAOYSA-N.

Identity
Molecular formulaC12H13ClO3
Molecular weight240.68 g/mol
IUPAC nameethyl 4-(4-chlorophenyl)-4-oxobutanoate
InChIKeyYKJFOAUMSHLSEB-UHFFFAOYSA-N
SMILESCCOC(=O)CCC(=O)C1=CC=C(C=C1)Cl

Computed by PubChem (NCBI)