Products 17392-16-4

CAS 17392-16-4 is the registry number for 2-(2-Hydroxyphenyl)-2-oxoacetic acid. Offered by: Biosynth. Available pack sizes: 10mg, 25mg, 50mg, 100mg, 250mg.

Structural formula: {0} (CAS {1})

2-(2-hydroxyphenyl)-2-oxoacetic acid (CAS 17392-16-4) is a chemical compound with the molecular formula C8H6O4 and a molecular weight of 166.13 g/mol. IUPAC name: 2-(2-hydroxyphenyl)-2-oxoacetic acid. InChIKey: QQSFIAWCKMCGNN-UHFFFAOYSA-N.

Identity
Molecular formulaC8H6O4
Molecular weight166.13 g/mol
IUPAC name2-(2-hydroxyphenyl)-2-oxoacetic acid
InChIKeyQQSFIAWCKMCGNN-UHFFFAOYSA-N
SMILESC1=CC=C(C(=C1)C(=O)C(=O)O)O

Computed by PubChem (NCBI)