CAS 17404-90-9 appears in our catalog under these names: 3-Chlorocinnoline, 97%, 3–Chlorocinnoline. Offered by: Combi-blocks, GLPBio. Available pack sizes: 250mg, 1g.
3-chlorocinnoline (CAS 17404-90-9) is a chemical compound with the molecular formula C8H5ClN2 and a molecular weight of 164.59 g/mol. IUPAC name: 3-chlorocinnoline. InChIKey: REUOCJLVDZPJEK-UHFFFAOYSA-N.
| Molecular formula | C8H5ClN2 |
|---|---|
| Molecular weight | 164.59 g/mol |
| IUPAC name | 3-chlorocinnoline |
| InChIKey | REUOCJLVDZPJEK-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C=C(N=N2)Cl |
Computed by PubChem (NCBI)