Products 174198-29-9

CAS 174198-29-9 is the registry number for 4,5,6,7-Tetrahydro-2h-indazole-3-carboxylic acid ethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 10g.

Structural formula: {0} (CAS {1})

Ethyl 4,5,6,7-tetrahydro-1H-indazole-3-carboxylate (CAS 174198-29-9) is a chemical compound with the molecular formula C10H14N2O2 and a molecular weight of 194.23 g/mol. IUPAC name: ethyl 4,5,6,7-tetrahydro-1H-indazole-3-carboxylate. InChIKey: HESKTUHERVMQMI-UHFFFAOYSA-N.

Identity
Molecular formulaC10H14N2O2
Molecular weight194.23 g/mol
IUPAC nameethyl 4,5,6,7-tetrahydro-1H-indazole-3-carboxylate
InChIKeyHESKTUHERVMQMI-UHFFFAOYSA-N
SMILESCCOC(=O)C1=NNC2=C1CCCC2

Computed by PubChem (NCBI)