CAS 1742-31-0 is the registry number for 1-(4-Chlorophenyl)-2,3-dimethylbutan-2-amine. Offered by: Biosynth. Available pack sizes: 100mg, 10mg, 25mg, 50mg, 250mg.
1-(4-chlorophenyl)-2,3-dimethylbutan-2-amine (CAS 1742-31-0) is a chemical compound with the molecular formula C12H18ClN and a molecular weight of 211.73 g/mol. IUPAC name: 1-(4-chlorophenyl)-2,3-dimethylbutan-2-amine. InChIKey: PDFDJJOGWLXPIV-UHFFFAOYSA-N.
| Molecular formula | C12H18ClN |
|---|---|
| Molecular weight | 211.73 g/mol |
| IUPAC name | 1-(4-chlorophenyl)-2,3-dimethylbutan-2-amine |
| InChIKey | PDFDJJOGWLXPIV-UHFFFAOYSA-N |
| SMILES | CC(C)C(C)(CC1=CC=C(C=C1)Cl)N |
Computed by PubChem (NCBI)