CAS 17433-92-0 appears in our catalog under these names: N-(3-Nitrophenyl)hydrazinecarboxamide, 95%, N-(3-Nitrophenyl)hydrazinecarboxamide. Offered by: Combi-blocks, Biosynth. Available pack sizes: 1g, 250mg, 2g, 5g.
1-amino-3-(3-nitrophenyl)urea (CAS 17433-92-0) is a chemical compound with the molecular formula C7H8N4O3 and a molecular weight of 196.16 g/mol. IUPAC name: 1-amino-3-(3-nitrophenyl)urea. InChIKey: HMXUVXPEGALDTB-UHFFFAOYSA-N.
| Molecular formula | C7H8N4O3 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | 1-amino-3-(3-nitrophenyl)urea |
| InChIKey | HMXUVXPEGALDTB-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)[N+](=O)[O-])NC(=O)NN |
Computed by PubChem (NCBI)