CAS 893770-15-5 is the registry number for (3,5-Dimethyl-2,4,6-trioxo-1,3,5-triazinan-1-yl)acetonitrile, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
2-(3,5-dimethyl-2,4,6-trioxo-1,3,5-triazinan-1-yl)acetonitrile (CAS 893770-15-5) is a chemical compound with the molecular formula C7H8N4O3 and a molecular weight of 196.16 g/mol. IUPAC name: 2-(3,5-dimethyl-2,4,6-trioxo-1,3,5-triazinan-1-yl)acetonitrile. InChIKey: NCXCZPPXVLQATE-UHFFFAOYSA-N.
| Molecular formula | C7H8N4O3 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | 2-(3,5-dimethyl-2,4,6-trioxo-1,3,5-triazinan-1-yl)acetonitrile |
| InChIKey | NCXCZPPXVLQATE-UHFFFAOYSA-N |
| SMILES | CN1C(=O)N(C(=O)N(C1=O)CC#N)C |
Computed by PubChem (NCBI)