CAS 330439-22-0 is the registry number for 2-methyl-5-nitronicotinohydrazide. Offered by: Chemat Brand. Available pack sizes: on request.
2-methyl-5-nitropyridine-3-carbohydrazide (CAS 330439-22-0) is a chemical compound with the molecular formula C7H8N4O3 and a molecular weight of 196.16 g/mol. IUPAC name: 2-methyl-5-nitropyridine-3-carbohydrazide. InChIKey: CZEZANJUZZKJJC-UHFFFAOYSA-N.
| Molecular formula | C7H8N4O3 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | 2-methyl-5-nitropyridine-3-carbohydrazide |
| InChIKey | CZEZANJUZZKJJC-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=N1)[N+](=O)[O-])C(=O)NN |
Computed by PubChem (NCBI)