CAS 31481-85-3 is the registry number for 4-(2-Acetylhydrazino)-3-nitropyridine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
N'-(3-nitro-4-pyridinyl)acetohydrazide (CAS 31481-85-3) is a chemical compound with the molecular formula C7H8N4O3 and a molecular weight of 196.16 g/mol. IUPAC name: N'-(3-nitro-4-pyridinyl)acetohydrazide. InChIKey: MZXDFFGWNNDJEP-UHFFFAOYSA-N.
| Molecular formula | C7H8N4O3 |
|---|---|
| Molecular weight | 196.16 g/mol |
| IUPAC name | N'-(3-nitro-4-pyridinyl)acetohydrazide |
| InChIKey | MZXDFFGWNNDJEP-UHFFFAOYSA-N |
| SMILES | CC(=O)NNC1=C(C=NC=C1)[N+](=O)[O-] |
Computed by PubChem (NCBI)